About [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane
[2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane (PubChem CID 68913843) has the molecular formula C40H51OP
and a molecular weight of 578.82 g/mol. Its IUPAC name is [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane.
Molecular Properties
| Compound Name | [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane |
| PubChem CID | 68913843 |
| Molecular Formula | C40H51OP |
| Molecular Weight | 578.82 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane |
| SMILES | CC(C)(C)c1ccc(-c2c(OP)ccc(-c3ccccc3)c2-c2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H51OP/c1-37(2,3)27-18-20-30(32(24-27)39(7,8)9)35-29(26-16-14-13-15-17-26)22-23-34(41-42)36(35)31-21-19-28(38(4,5)6)25-33(31)40(10,11)12/h13-25H,42H2,1-12H3 |
| InChIKey | NMSCMMYBDWHNAL-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 578.82 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane?
The IUPAC name of [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane (CID 68913843) is [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane.
What is the SMILES notation for [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane?
The canonical SMILES for [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane is CC(C)(C)c1ccc(-c2c(OP)ccc(-c3ccccc3)c2-c2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1.
What is the InChIKey of [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane?
The InChIKey is NMSCMMYBDWHNAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H51OP/c1-37(2,3)27-18-20-30(32(24-27)39(7,8)9)35-29(26-16-14-13-15-17-26)22-23-34(41-42)36(35)31-21-19-28(38(4,5)6)25-33(31)40(10,11)12/h13-25H,42H2,1-12H3.
What are the key properties of [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane?
[2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane has a molecular weight of 578.82 g/mol, XLogP of 12.05, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(2,4-ditert-butylphenyl)-4-phenylphenoxy]phosphane is sourced from PubChem (CID 68913843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).