C19H19FN2 — CID 68914493
[(1S,3R)-3-(5-fluoro-2-methyl-1H-indol-3-yl)-2,3-dihydro-1H-inden-1-yl]methanamine (PubChem CID 68914493) has the molecular formula C19H19FN2 and a molecular weight of 294.37 g/mol. Its IUPAC name is [(1S,3R)-3-(5-fluoro-2-methyl-1H-indol-3-yl)-2,3-dihydro-1H-inden-1-yl]methanamine.
| Compound Name | [(1S,3R)-3-(5-fluoro-2-methyl-1H-indol-3-yl)-2,3-dihydro-1H-inden-1-yl]methanamine |
|---|---|
| PubChem CID | 68914493 |
| Molecular Formula | C19H19FN2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [(1S,3R)-3-(5-fluoro-2-methyl-1H-indol-3-yl)-2,3-dihydro-1H-inden-1-yl]methanamine |
| SMILES | Cc1[nH]c2ccc(F)cc2c1[C@@H]1C[C@H](CN)c2ccccc21 |
| InChI | InChI=1S/C19H19FN2/c1-11-19(17-9-13(20)6-7-18(17)22-11)16-8-12(10-21)14-4-2-3-5-15(14)16/h2-7,9,12,16,22H,8,10,21H2,1H3/t12-,16-/m1/s1 |
| InChIKey | ADVVUKHKMLITCQ-MLGOLLRUSA-N |
| XLogP | 4.19 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|