C24H29F3N6O3S — CID 68914518
1-[3-(dimethylamino)propyl]-3-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]urea (PubChem CID 68914518) has the molecular formula C24H29F3N6O3S and a molecular weight of 538.60 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]urea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]urea |
|---|---|
| PubChem CID | 68914518 |
| Molecular Formula | C24H29F3N6O3S |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]urea |
| SMILES | CN(C)CCCNC(=O)Nc1cc(CN2C(=O)N(c3ccc(SC(F)(F)F)cc3)C(=O)C2(C)C)ccn1 |
| InChI | InChI=1S/C24H29F3N6O3S/c1-23(2)20(34)33(17-6-8-18(9-7-17)37-24(25,26)27)22(36)32(23)15-16-10-12-28-19(14-16)30-21(35)29-11-5-13-31(3)4/h6-10,12,14H,5,11,13,15H2,1-4H3,(H2,28,29,30,35) |
| InChIKey | GDSXQEMDEPFVIA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|