About [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol
[2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol (PubChem CID 6891493) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol.
Molecular Properties
| Compound Name | [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol |
| PubChem CID | 6891493 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol |
| SMILES | CCc1cc(CC)c(CO)c(CC)c1/C=N/O |
| InChI | InChI=1S/C14H21NO2/c1-4-10-7-11(5-2)14(9-16)12(6-3)13(10)8-15-17/h7-8,16-17H,4-6,9H2,1-3H3/b15-8+ |
| InChIKey | BBHDVUIOGNDJGN-OVCLIPMQSA-N |
| XLogP | 2.67 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol?
The IUPAC name of [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol (CID 6891493) is [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol.
What is the SMILES notation for [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol?
The canonical SMILES for [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol is CCc1cc(CC)c(CO)c(CC)c1/C=N/O.
What is the InChIKey of [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol?
The InChIKey is BBHDVUIOGNDJGN-OVCLIPMQSA-N. The full InChI is InChI=1S/C14H21NO2/c1-4-10-7-11(5-2)14(9-16)12(6-3)13(10)8-15-17/h7-8,16-17H,4-6,9H2,1-3H3/b15-8+.
What are the key properties of [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol?
[2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol has a molecular weight of 235.33 g/mol, XLogP of 2.67, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4,6-triethyl-3-[(E)-hydroxyiminomethyl]phenyl]methanol is sourced from PubChem (CID 6891493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).