C20H36O8Si — CID 68915260
(3aR,6R,6aR)-6-[(4S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 68915260) has the molecular formula C20H36O8Si and a molecular weight of 432.59 g/mol. Its IUPAC name is (3aR,6R,6aR)-6-[(4S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aR,6R,6aR)-6-[(4S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 68915260 |
| Molecular Formula | C20H36O8Si |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | (3aR,6R,6aR)-6-[(4S,5S)-5-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | CC1(C)O[C@H]([C@H]2OC(=O)[C@@H]3OC(C)(C)O[C@H]23)[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C20H36O8Si/c1-18(2,3)29(8,9)23-10-11(21)12-14(26-19(4,5)25-12)13-15-16(17(22)24-13)28-20(6,7)27-15/h11-16,21H,10H2,1-9H3/t11-,12+,13-,14+,15-,16-/m1/s1 |
| InChIKey | UYBPNDNYOSDUHD-ZTYXSZCMSA-N |
| XLogP | 2.33 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|