About 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine
2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine (PubChem CID 68915549) has the molecular formula C19H17FN4O2
and a molecular weight of 352.37 g/mol. Its IUPAC name is 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine |
| PubChem CID | 68915549 |
| Molecular Formula | C19H17FN4O2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine |
| SMILES | CN(c1ccc2c(c1)OCCO2)c1nc(-c2cccc(N)c2)ncc1F |
| InChI | InChI=1S/C19H17FN4O2/c1-24(14-5-6-16-17(10-14)26-8-7-25-16)19-15(20)11-22-18(23-19)12-3-2-4-13(21)9-12/h2-6,9-11H,7-8,21H2,1H3 |
| InChIKey | KKVVUOWAJGHGAU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine?
The IUPAC name of 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine (CID 68915549) is 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine.
What is the SMILES notation for 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine?
The canonical SMILES for 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine is CN(c1ccc2c(c1)OCCO2)c1nc(-c2cccc(N)c2)ncc1F.
What is the InChIKey of 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine?
The InChIKey is KKVVUOWAJGHGAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN4O2/c1-24(14-5-6-16-17(10-14)26-8-7-25-16)19-15(20)11-22-18(23-19)12-3-2-4-13(21)9-12/h2-6,9-11H,7-8,21H2,1H3.
What are the key properties of 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine?
2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine has a molecular weight of 352.37 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminophenyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-fluoro-N-methylpyrimidin-4-amine is sourced from PubChem (CID 68915549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).