About N-ethyl-4-(1,3,5-triazin-2-yl)benzamide
N-ethyl-4-(1,3,5-triazin-2-yl)benzamide (PubChem CID 68915705) has the molecular formula C12H12N4O
and a molecular weight of 228.25 g/mol. Its IUPAC name is N-ethyl-4-(1,3,5-triazin-2-yl)benzamide.
Molecular Properties
| Compound Name | N-ethyl-4-(1,3,5-triazin-2-yl)benzamide |
| PubChem CID | 68915705 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | N-ethyl-4-(1,3,5-triazin-2-yl)benzamide |
| SMILES | CCNC(=O)c1ccc(-c2ncncn2)cc1 |
| InChI | InChI=1S/C12H12N4O/c1-2-14-12(17)10-5-3-9(4-6-10)11-15-7-13-8-16-11/h3-8H,2H2,1H3,(H,14,17) |
| InChIKey | ZMQOUVRKOBXSRL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-4-(1,3,5-triazin-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-(1,3,5-triazin-2-yl)benzamide?
The IUPAC name of N-ethyl-4-(1,3,5-triazin-2-yl)benzamide (CID 68915705) is N-ethyl-4-(1,3,5-triazin-2-yl)benzamide.
What is the SMILES notation for N-ethyl-4-(1,3,5-triazin-2-yl)benzamide?
The canonical SMILES for N-ethyl-4-(1,3,5-triazin-2-yl)benzamide is CCNC(=O)c1ccc(-c2ncncn2)cc1.
What is the InChIKey of N-ethyl-4-(1,3,5-triazin-2-yl)benzamide?
The InChIKey is ZMQOUVRKOBXSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O/c1-2-14-12(17)10-5-3-9(4-6-10)11-15-7-13-8-16-11/h3-8H,2H2,1H3,(H,14,17).
What are the key properties of N-ethyl-4-(1,3,5-triazin-2-yl)benzamide?
N-ethyl-4-(1,3,5-triazin-2-yl)benzamide has a molecular weight of 228.25 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-(1,3,5-triazin-2-yl)benzamide is sourced from PubChem (CID 68915705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).