C27H36F2N2O4S — CID 68916802
tert-butyl N-[(2R)-6-[[4-(1,1-difluoropropan-2-yl)phenyl]sulfonylamino]-1,2,3,4-tetrahydronaphthalen-2-yl]-N-propylcarbamate (PubChem CID 68916802) has the molecular formula C27H36F2N2O4S and a molecular weight of 522.66 g/mol. Its IUPAC name is tert-butyl N-[(2R)-6-[[4-(1,1-difluoropropan-2-yl)phenyl]sulfonylamino]-1,2,3,4-tetrahydronaphthalen-2-yl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[(2R)-6-[[4-(1,1-difluoropropan-2-yl)phenyl]sulfonylamino]-1,2,3,4-tetrahydronaphthalen-2-yl]-N-propylcarbamate |
|---|---|
| PubChem CID | 68916802 |
| Molecular Formula | C27H36F2N2O4S |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | tert-butyl N-[(2R)-6-[[4-(1,1-difluoropropan-2-yl)phenyl]sulfonylamino]-1,2,3,4-tetrahydronaphthalen-2-yl]-N-propylcarbamate |
| SMILES | CCCN(C(=O)OC(C)(C)C)[C@@H]1CCc2cc(NS(=O)(=O)c3ccc(C(C)C(F)F)cc3)ccc2C1 |
| InChI | InChI=1S/C27H36F2N2O4S/c1-6-15-31(26(32)35-27(3,4)5)23-12-8-20-16-22(11-7-21(20)17-23)30-36(33,34)24-13-9-19(10-14-24)18(2)25(28)29/h7,9-11,13-14,16,18,23,25,30H,6,8,12,15,17H2,1-5H3/t18?,23-/m1/s1 |
| InChIKey | NJEOQDASIXHQJN-WBPHRXDCSA-N |
| XLogP | 6.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |