C28H22F3N5O — CID 68917373
4-[[4-[2,6-dimethyl-4-(3,3,5-trifluorocyclohexa-1,5-dien-1-yl)phenoxy]-5-methylpyrrolo[3,2-d]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 68917373) has the molecular formula C28H22F3N5O and a molecular weight of 501.51 g/mol. Its IUPAC name is 4-[[4-[2,6-dimethyl-4-(3,3,5-trifluorocyclohexa-1,5-dien-1-yl)phenoxy]-5-methylpyrrolo[3,2-d]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[2,6-dimethyl-4-(3,3,5-trifluorocyclohexa-1,5-dien-1-yl)phenoxy]-5-methylpyrrolo[3,2-d]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 68917373 |
| Molecular Formula | C28H22F3N5O |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 4-[[4-[2,6-dimethyl-4-(3,3,5-trifluorocyclohexa-1,5-dien-1-yl)phenoxy]-5-methylpyrrolo[3,2-d]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C2=CC(F)(F)CC(F)=C2)cc(C)c1Oc1nc(Nc2ccc(C#N)cc2)nc2ccn(C)c12 |
| InChI | InChI=1S/C28H22F3N5O/c1-16-10-19(20-12-21(29)14-28(30,31)13-20)11-17(2)25(16)37-26-24-23(8-9-36(24)3)34-27(35-26)33-22-6-4-18(15-32)5-7-22/h4-13H,14H2,1-3H3,(H,33,34,35) |
| InChIKey | CQUKOKZBLHZMGW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |