About 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide
1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide (PubChem CID 68917539) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide |
| PubChem CID | 68917539 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide |
| SMILES | NC(=O)CN1C=CCN(C(N)=O)C1 |
| InChI | InChI=1S/C7H12N4O2/c8-6(12)4-10-2-1-3-11(5-10)7(9)13/h1-2H,3-5H2,(H2,8,12)(H2,9,13) |
| InChIKey | FKNUXIJOSRTYME-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide?
The IUPAC name of 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide (CID 68917539) is 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide.
What is the SMILES notation for 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide?
The canonical SMILES for 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide is NC(=O)CN1C=CCN(C(N)=O)C1.
What is the InChIKey of 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide?
The InChIKey is FKNUXIJOSRTYME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2/c8-6(12)4-10-2-1-3-11(5-10)7(9)13/h1-2H,3-5H2,(H2,8,12)(H2,9,13).
What are the key properties of 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide?
1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide has a molecular weight of 184.20 g/mol, XLogP of -1.36, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-2-oxoethyl)-2,4-dihydropyrimidine-3-carboxamide is sourced from PubChem (CID 68917539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).