C22H22N4O2S — CID 6891766
N-[(E)-[1-[2-(2-methoxy-4-methylphenoxy)ethyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 6891766) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-[(E)-[1-[2-(2-methoxy-4-methylphenoxy)ethyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-[1-[2-(2-methoxy-4-methylphenoxy)ethyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 6891766 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[(E)-[1-[2-(2-methoxy-4-methylphenoxy)ethyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | COc1cc(C)ccc1OCCn1cccc1/C=N/Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H22N4O2S/c1-16-9-10-19(20(14-16)27-2)28-13-12-26-11-5-6-17(26)15-23-25-22-24-18-7-3-4-8-21(18)29-22/h3-11,14-15H,12-13H2,1-2H3,(H,24,25)/b23-15+ |
| InChIKey | XTGCREBGOLBICR-HZHRSRAPSA-N |
| XLogP | 4.94 |
| TPSA | 60.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|