C26H32F3N7O2 — CID 68917970
N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-8-[(1-methylpyrazol-4-yl)methyl]-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide (PubChem CID 68917970) has the molecular formula C26H32F3N7O2 and a molecular weight of 531.58 g/mol. Its IUPAC name is N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-8-[(1-methylpyrazol-4-yl)methyl]-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide.
| Compound Name | N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-8-[(1-methylpyrazol-4-yl)methyl]-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide |
|---|---|
| PubChem CID | 68917970 |
| Molecular Formula | C26H32F3N7O2 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | N-[3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-8-[(1-methylpyrazol-4-yl)methyl]-3-(2,4,5-trifluorophenyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide |
| SMILES | CNC(=O)C(NC(=O)c1nc(-c2cc(F)c(F)cc2F)n2c1CN(Cc1cnn(C)c1)CCC2)C(C)(C)C |
| InChI | InChI=1S/C26H32F3N7O2/c1-26(2,3)22(25(38)30-4)33-24(37)21-20-14-35(13-15-11-31-34(5)12-15)7-6-8-36(20)23(32-21)16-9-18(28)19(29)10-17(16)27/h9-12,22H,6-8,13-14H2,1-5H3,(H,30,38)(H,33,37) |
| InChIKey | JOBWZQCZFFERTM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|