C24H25N5 — CID 68918017
2-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-3-(3-imidazol-1-ylpropyl)quinoline-2,6-diamine (PubChem CID 68918017) has the molecular formula C24H25N5 and a molecular weight of 383.50 g/mol. Its IUPAC name is 2-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-3-(3-imidazol-1-ylpropyl)quinoline-2,6-diamine.
| Compound Name | 2-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-3-(3-imidazol-1-ylpropyl)quinoline-2,6-diamine |
|---|---|
| PubChem CID | 68918017 |
| Molecular Formula | C24H25N5 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 2-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-3-(3-imidazol-1-ylpropyl)quinoline-2,6-diamine |
| SMILES | Nc1ccc2nc(N[C@@H]3CCc4ccccc43)c(CCCn3ccnc3)cc2c1 |
| InChI | InChI=1S/C24H25N5/c25-20-8-10-22-19(15-20)14-18(5-3-12-29-13-11-26-16-29)24(27-22)28-23-9-7-17-4-1-2-6-21(17)23/h1-2,4,6,8,10-11,13-16,23H,3,5,7,9,12,25H2,(H,27,28)/t23-/m1/s1 |
| InChIKey | XRVIKLATVYIGLT-HSZRJFAPSA-N |
| XLogP | 4.75 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|