About 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide
6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide (PubChem CID 68918921) has the molecular formula C10H11NO4S
and a molecular weight of 241.27 g/mol. Its IUPAC name is 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide.
Molecular Properties
| Compound Name | 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide |
| PubChem CID | 68918921 |
| Molecular Formula | C10H11NO4S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide |
| SMILES | NS(=O)(=O)C1=COC=C(C2=CC=CCC2)O1 |
| InChI | InChI=1S/C10H11NO4S/c11-16(12,13)10-7-14-6-9(15-10)8-4-2-1-3-5-8/h1-2,4,6-7H,3,5H2,(H2,11,12,13) |
| InChIKey | SYDATBSSYIMWKR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide?
The IUPAC name of 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide (CID 68918921) is 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide.
What is the SMILES notation for 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide?
The canonical SMILES for 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide is NS(=O)(=O)C1=COC=C(C2=CC=CCC2)O1.
What is the InChIKey of 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide?
The InChIKey is SYDATBSSYIMWKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO4S/c11-16(12,13)10-7-14-6-9(15-10)8-4-2-1-3-5-8/h1-2,4,6-7H,3,5H2,(H2,11,12,13).
What are the key properties of 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide?
6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide has a molecular weight of 241.27 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexa-1,3-dien-1-yl-1,4-dioxine-2-sulfonamide is sourced from PubChem (CID 68918921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).