C22H28ClF2N5O2 — CID 68919885
3-(5-chloro-2,4-difluorophenyl)-N-[1-(ethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1-carboxamide (PubChem CID 68919885) has the molecular formula C22H28ClF2N5O2 and a molecular weight of 467.95 g/mol. Its IUPAC name is 3-(5-chloro-2,4-difluorophenyl)-N-[1-(ethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1-carboxamide.
| Compound Name | 3-(5-chloro-2,4-difluorophenyl)-N-[1-(ethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1-carboxamide |
|---|---|
| PubChem CID | 68919885 |
| Molecular Formula | C22H28ClF2N5O2 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 3-(5-chloro-2,4-difluorophenyl)-N-[1-(ethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepine-1-carboxamide |
| SMILES | CCNC(=O)C(NC(=O)c1nc(-c2cc(Cl)c(F)cc2F)n2c1CNCCC2)C(C)(C)C |
| InChI | InChI=1S/C22H28ClF2N5O2/c1-5-27-21(32)18(22(2,3)4)29-20(31)17-16-11-26-7-6-8-30(16)19(28-17)12-9-13(23)15(25)10-14(12)24/h9-10,18,26H,5-8,11H2,1-4H3,(H,27,32)(H,29,31) |
| InChIKey | JYIUYNBLRRFBOH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|