C19H15NO6S — CID 68919892
6-(benzylcarbamoyl)-3-(carboxymethoxy)-1-benzothiophene-2-carboxylic acid (PubChem CID 68919892) has the molecular formula C19H15NO6S and a molecular weight of 385.40 g/mol. Its IUPAC name is 6-(benzylcarbamoyl)-3-(carboxymethoxy)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 6-(benzylcarbamoyl)-3-(carboxymethoxy)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68919892 |
| Molecular Formula | C19H15NO6S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 6-(benzylcarbamoyl)-3-(carboxymethoxy)-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)COc1c(C(=O)O)sc2cc(C(=O)NCc3ccccc3)ccc12 |
| InChI | InChI=1S/C19H15NO6S/c21-15(22)10-26-16-13-7-6-12(8-14(13)27-17(16)19(24)25)18(23)20-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | TZYAWVHWERQTBJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |