About 1-nonylpurine-2,6-dione
1-nonylpurine-2,6-dione (PubChem CID 68921284) has the molecular formula C14H20N4O2
and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-nonylpurine-2,6-dione.
Molecular Properties
| Compound Name | 1-nonylpurine-2,6-dione |
| PubChem CID | 68921284 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-nonylpurine-2,6-dione |
| SMILES | CCCCCCCCCN1C(=O)N=C2N=CN=C2C1=O |
| InChI | InChI=1S/C14H20N4O2/c1-2-3-4-5-6-7-8-9-18-13(19)11-12(16-10-15-11)17-14(18)20/h10H,2-9H2,1H3 |
| InChIKey | FOZDBUORGUIRTQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-nonylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nonylpurine-2,6-dione?
The IUPAC name of 1-nonylpurine-2,6-dione (CID 68921284) is 1-nonylpurine-2,6-dione.
What is the SMILES notation for 1-nonylpurine-2,6-dione?
The canonical SMILES for 1-nonylpurine-2,6-dione is CCCCCCCCCN1C(=O)N=C2N=CN=C2C1=O.
What is the InChIKey of 1-nonylpurine-2,6-dione?
The InChIKey is FOZDBUORGUIRTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O2/c1-2-3-4-5-6-7-8-9-18-13(19)11-12(16-10-15-11)17-14(18)20/h10H,2-9H2,1H3.
What are the key properties of 1-nonylpurine-2,6-dione?
1-nonylpurine-2,6-dione has a molecular weight of 276.34 g/mol, XLogP of 2.58, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonylpurine-2,6-dione is sourced from PubChem (CID 68921284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).