About ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate
ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate (PubChem CID 68921482) has the molecular formula C12H12FNO2
and a molecular weight of 221.23 g/mol. Its IUPAC name is ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate |
| PubChem CID | 68921482 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate |
| SMILES | CCOC(=O)C1=NCCc2cc(F)ccc21 |
| InChI | InChI=1S/C12H12FNO2/c1-2-16-12(15)11-10-4-3-9(13)7-8(10)5-6-14-11/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | XPKGSZBTAQWHNJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate?
The IUPAC name of ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate (CID 68921482) is ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate.
What is the SMILES notation for ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate?
The canonical SMILES for ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate is CCOC(=O)C1=NCCc2cc(F)ccc21.
What is the InChIKey of ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate?
The InChIKey is XPKGSZBTAQWHNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO2/c1-2-16-12(15)11-10-4-3-9(13)7-8(10)5-6-14-11/h3-4,7H,2,5-6H2,1H3.
What are the key properties of ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate?
ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate has a molecular weight of 221.23 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-fluoro-3,4-dihydroisoquinoline-1-carboxylate is sourced from PubChem (CID 68921482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).