About [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate
[2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate (PubChem CID 68922480) has the molecular formula C16H16N2O7
and a molecular weight of 348.31 g/mol. Its IUPAC name is [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate |
| PubChem CID | 68922480 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate |
| SMILES | CC(=O)Oc1ccccc1C(=O)OC1(C)NC=CC=C1CO[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N2O7/c1-11(19)24-14-8-4-3-7-13(14)15(20)25-16(2)12(6-5-9-17-16)10-23-18(21)22/h3-9,17H,10H2,1-2H3 |
| InChIKey | AYYSVDDBOROPPP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate?
The IUPAC name of [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate (CID 68922480) is [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate.
What is the SMILES notation for [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate?
The canonical SMILES for [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate is CC(=O)Oc1ccccc1C(=O)OC1(C)NC=CC=C1CO[N+](=O)[O-].
What is the InChIKey of [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate?
The InChIKey is AYYSVDDBOROPPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O7/c1-11(19)24-14-8-4-3-7-13(14)15(20)25-16(2)12(6-5-9-17-16)10-23-18(21)22/h3-9,17H,10H2,1-2H3.
What are the key properties of [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate?
[2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate has a molecular weight of 348.31 g/mol, XLogP of 1.74, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-3-(nitrooxymethyl)-1H-pyridin-2-yl] 2-acetyloxybenzoate is sourced from PubChem (CID 68922480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).