About [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride
[(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride (PubChem CID 68922618) has the molecular formula C17H17ClF3N
and a molecular weight of 327.78 g/mol. Its IUPAC name is [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride |
| PubChem CID | 68922618 |
| Molecular Formula | C17H17ClF3N |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride |
| SMILES | Cl.NC[C@@H]1C[C@H]1c1cccc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H16F3N.ClH/c18-17(19,20)15-6-4-11(5-7-15)12-2-1-3-13(8-12)16-9-14(16)10-21;/h1-8,14,16H,9-10,21H2;1H/t14-,16-;/m0./s1 |
| InChIKey | ADFFPOQRVAHNJP-DMLYUBSXSA-N |
| XLogP | 4.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride?
The IUPAC name of [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride (CID 68922618) is [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride.
What is the SMILES notation for [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride?
The canonical SMILES for [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride is Cl.NC[C@@H]1C[C@H]1c1cccc(-c2ccc(C(F)(F)F)cc2)c1.
What is the InChIKey of [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride?
The InChIKey is ADFFPOQRVAHNJP-DMLYUBSXSA-N. The full InChI is InChI=1S/C17H16F3N.ClH/c18-17(19,20)15-6-4-11(5-7-15)12-2-1-3-13(8-12)16-9-14(16)10-21;/h1-8,14,16H,9-10,21H2;1H/t14-,16-;/m0./s1.
What are the key properties of [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride?
[(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride has a molecular weight of 327.78 g/mol, XLogP of 4.86, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]cyclopropyl]methanamine;hydrochloride is sourced from PubChem (CID 68922618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).