C23H31ClFN5O2 — CID 68922867
3-(5-chloro-2-fluorophenyl)-N-[1-(ethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide (PubChem CID 68922867) has the molecular formula C23H31ClFN5O2 and a molecular weight of 463.99 g/mol. Its IUPAC name is 3-(5-chloro-2-fluorophenyl)-N-[1-(ethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide.
| Compound Name | 3-(5-chloro-2-fluorophenyl)-N-[1-(ethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide |
|---|---|
| PubChem CID | 68922867 |
| Molecular Formula | C23H31ClFN5O2 |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 3-(5-chloro-2-fluorophenyl)-N-[1-(ethylamino)-3,3-dimethyl-1-oxobutan-2-yl]-8-methyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine-1-carboxamide |
| SMILES | CCNC(=O)C(NC(=O)c1nc(-c2cc(Cl)ccc2F)n2c1CN(C)CCC2)C(C)(C)C |
| InChI | InChI=1S/C23H31ClFN5O2/c1-6-26-22(32)19(23(2,3)4)28-21(31)18-17-13-29(5)10-7-11-30(17)20(27-18)15-12-14(24)8-9-16(15)25/h8-9,12,19H,6-7,10-11,13H2,1-5H3,(H,26,32)(H,28,31) |
| InChIKey | CEPLLRUXMFXGRZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |