About CID 68922974
CID 68922974 (PubChem CID 68922974) has the molecular formula C35H43N2O5Si
and a molecular weight of 599.82 g/mol.
Molecular Properties
| Compound Name | CID 68922974 |
| PubChem CID | 68922974 |
| Molecular Formula | C35H43N2O5Si |
| Molecular Weight | 599.82 g/mol |
| Exact Mass | 599.29 |
| IUPAC Name | — |
| SMILES | CCCOc1ccc2c(CCC3CCN(C(=O)O)CC3)noc2c1C(O[Si](c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H43N2O5Si/c1-5-24-40-30-19-17-28-29(18-16-25-20-22-37(23-21-25)34(38)39)36-41-32(28)31(30)33(35(2,3)4)42-43(26-12-8-6-9-13-26)27-14-10-7-11-15-27/h6-15,17,19,25,33H,5,16,18,20-24H2,1-4H3,(H,38,39) |
| InChIKey | NDPXLFWKQDDCKQ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 599.82 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68922974 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68922974?
The IUPAC name of CID 68922974 (CID 68922974) is not available.
What is the SMILES notation for CID 68922974?
The canonical SMILES for CID 68922974 is CCCOc1ccc2c(CCC3CCN(C(=O)O)CC3)noc2c1C(O[Si](c1ccccc1)c1ccccc1)C(C)(C)C.
What is the InChIKey of CID 68922974?
The InChIKey is NDPXLFWKQDDCKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H43N2O5Si/c1-5-24-40-30-19-17-28-29(18-16-25-20-22-37(23-21-25)34(38)39)36-41-32(28)31(30)33(35(2,3)4)42-43(26-12-8-6-9-13-26)27-14-10-7-11-15-27/h6-15,17,19,25,33H,5,16,18,20-24H2,1-4H3,(H,38,39).
What are the key properties of CID 68922974?
CID 68922974 has a molecular weight of 599.82 g/mol, XLogP of 6.85, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68922974 is sourced from PubChem (CID 68922974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).