C24H30O5 — CID 68923240
2-methoxy-1-propan-2-yloxy-6-(3,4,5-trimethoxyphenyl)-8,9-dihydro-7H-benzo[7]annulene (PubChem CID 68923240) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is 2-methoxy-1-propan-2-yloxy-6-(3,4,5-trimethoxyphenyl)-8,9-dihydro-7H-benzo[7]annulene.
| Compound Name | 2-methoxy-1-propan-2-yloxy-6-(3,4,5-trimethoxyphenyl)-8,9-dihydro-7H-benzo[7]annulene |
|---|---|
| PubChem CID | 68923240 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-methoxy-1-propan-2-yloxy-6-(3,4,5-trimethoxyphenyl)-8,9-dihydro-7H-benzo[7]annulene |
| SMILES | COc1cc(C2=Cc3ccc(OC)c(OC(C)C)c3CCC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H30O5/c1-15(2)29-23-19-9-7-8-16(12-17(19)10-11-20(23)25-3)18-13-21(26-4)24(28-6)22(14-18)27-5/h10-15H,7-9H2,1-6H3 |
| InChIKey | KPBPIRIVJQJBAI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|