C21H22N2O2 — CID 68923339
ethyl 5-benzyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 68923339) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is ethyl 5-benzyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | ethyl 5-benzyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 68923339 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | ethyl 5-benzyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)c1c(n2Cc2ccccc2)CCNC1 |
| InChI | InChI=1S/C21H22N2O2/c1-2-25-21(24)16-8-9-19-17(12-16)18-13-22-11-10-20(18)23(19)14-15-6-4-3-5-7-15/h3-9,12,22H,2,10-11,13-14H2,1H3 |
| InChIKey | NTOWHZTXELVEOG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|