C20H19BrN4O2S — CID 6892438
4-[(E)-[3-[(4-bromophenyl)methylsulfanyl]-5-propan-2-yl-1,2,4-triazol-4-yl]iminomethyl]benzoic acid (PubChem CID 6892438) has the molecular formula C20H19BrN4O2S and a molecular weight of 459.37 g/mol. Its IUPAC name is 4-[(E)-[3-[(4-bromophenyl)methylsulfanyl]-5-propan-2-yl-1,2,4-triazol-4-yl]iminomethyl]benzoic acid.
| Compound Name | 4-[(E)-[3-[(4-bromophenyl)methylsulfanyl]-5-propan-2-yl-1,2,4-triazol-4-yl]iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 6892438 |
| Molecular Formula | C20H19BrN4O2S |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 4-[(E)-[3-[(4-bromophenyl)methylsulfanyl]-5-propan-2-yl-1,2,4-triazol-4-yl]iminomethyl]benzoic acid |
| SMILES | CC(C)c1nnc(SCc2ccc(Br)cc2)n1/N=C/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H19BrN4O2S/c1-13(2)18-23-24-20(28-12-15-5-9-17(21)10-6-15)25(18)22-11-14-3-7-16(8-4-14)19(26)27/h3-11,13H,12H2,1-2H3,(H,26,27)/b22-11+ |
| InChIKey | VHLPTMGDCUAAGX-SSDVNMTOSA-N |
| XLogP | 5.04 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|