C12H14N2 — CID 68924582
2-methyl-1,3,4,4a-tetrahydropyrido[4,3-b]indole (PubChem CID 68924582) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-methyl-1,3,4,4a-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-methyl-1,3,4,4a-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 68924582 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-methyl-1,3,4,4a-tetrahydropyrido[4,3-b]indole |
| SMILES | CN1CCC2N=c3ccccc3=C2C1 |
| InChI | InChI=1S/C12H14N2/c1-14-7-6-12-10(8-14)9-4-2-3-5-11(9)13-12/h2-5,12H,6-8H2,1H3 |
| InChIKey | HCRUMIWPLKGNMH-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |