C33H45N4O5Si — CID 68925535
CID 68925535 (PubChem CID 68925535) has the molecular formula C33H45N4O5Si and a molecular weight of 605.83 g/mol.
| Compound Name | CID 68925535 |
|---|---|
| PubChem CID | 68925535 |
| Molecular Formula | C33H45N4O5Si |
| Molecular Weight | 605.83 g/mol |
| Exact Mass | 605.32 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC(c1c(OCc2ccc(C#N)nc2)ccc2c(CCC3CCN(C(=O)OC(C)(C)C)CC3)noc12)C(C)(C)C |
| InChI | InChI=1S/C33H45N4O5Si/c1-32(2,3)30(42-43(7)8)28-27(39-21-23-9-11-24(19-34)35-20-23)14-12-25-26(36-41-29(25)28)13-10-22-15-17-37(18-16-22)31(38)40-33(4,5)6/h9,11-12,14,20,22,30H,10,13,15-18,21H2,1-8H3 |
| InChIKey | QLMZMWGRGIDQID-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 110.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.83 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|