C19H16F2N4O2 — CID 68925735
[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-(2-fluoro-4-pyridinyl)methanone (PubChem CID 68925735) has the molecular formula C19H16F2N4O2 and a molecular weight of 370.36 g/mol. Its IUPAC name is [3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-(2-fluoro-4-pyridinyl)methanone.
| Compound Name | [3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-(2-fluoro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 68925735 |
| Molecular Formula | C19H16F2N4O2 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-(2-fluoro-4-pyridinyl)methanone |
| SMILES | O=C(c1ccnc(F)c1)N1CCCC(c2nc(-c3ccc(F)cc3)no2)C1 |
| InChI | InChI=1S/C19H16F2N4O2/c20-15-5-3-12(4-6-15)17-23-18(27-24-17)14-2-1-9-25(11-14)19(26)13-7-8-22-16(21)10-13/h3-8,10,14H,1-2,9,11H2 |
| InChIKey | QFMMOKDCOXWAJZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|