About cyclononylcyclononane;bis(2-methylprop-2-enoic acid)
cyclononylcyclononane;bis(2-methylprop-2-enoic acid) (PubChem CID 68925875) has the molecular formula C26H46O4
and a molecular weight of 422.65 g/mol. Its IUPAC name is cyclononylcyclononane;bis(2-methylprop-2-enoic acid).
Molecular Properties
| Compound Name | cyclononylcyclononane;bis(2-methylprop-2-enoic acid) |
| PubChem CID | 68925875 |
| Molecular Formula | C26H46O4 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.34 |
| IUPAC Name | cyclononylcyclononane;bis(2-methylprop-2-enoic acid) |
| SMILES | C1CCCCC(C2CCCCCCCC2)CCC1.C=C(C)C(=O)O.C=C(C)C(=O)O |
| InChI | InChI=1S/C18H34.2C4H6O2/c1-2-6-10-14-17(13-9-5-1)18-15-11-7-3-4-8-12-16-18;2*1-3(2)4(5)6/h17-18H,1-16H2;2*1H2,2H3,(H,5,6) |
| InChIKey | FQMTXPASITVNCZ-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclononylcyclononane;bis(2-methylprop-2-enoic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclononylcyclononane;bis(2-methylprop-2-enoic acid)?
The IUPAC name of cyclononylcyclononane;bis(2-methylprop-2-enoic acid) (CID 68925875) is cyclononylcyclononane;bis(2-methylprop-2-enoic acid).
What is the SMILES notation for cyclononylcyclononane;bis(2-methylprop-2-enoic acid)?
The canonical SMILES for cyclononylcyclononane;bis(2-methylprop-2-enoic acid) is C1CCCCC(C2CCCCCCCC2)CCC1.C=C(C)C(=O)O.C=C(C)C(=O)O.
What is the InChIKey of cyclononylcyclononane;bis(2-methylprop-2-enoic acid)?
The InChIKey is FQMTXPASITVNCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34.2C4H6O2/c1-2-6-10-14-17(13-9-5-1)18-15-11-7-3-4-8-12-16-18;2*1-3(2)4(5)6/h17-18H,1-16H2;2*1H2,2H3,(H,5,6).
What are the key properties of cyclononylcyclononane;bis(2-methylprop-2-enoic acid)?
cyclononylcyclononane;bis(2-methylprop-2-enoic acid) has a molecular weight of 422.65 g/mol, XLogP of 7.78, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclononylcyclononane;bis(2-methylprop-2-enoic acid) is sourced from PubChem (CID 68925875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).