C21H23N3O2 — CID 68926031
ethyl 2-methyl-5-(pyridin-4-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate (PubChem CID 68926031) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 2-methyl-5-(pyridin-4-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate.
| Compound Name | ethyl 2-methyl-5-(pyridin-4-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 68926031 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | ethyl 2-methyl-5-(pyridin-4-ylmethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole-8-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)c1c(n2Cc2ccncc2)CCN(C)C1 |
| InChI | InChI=1S/C21H23N3O2/c1-3-26-21(25)16-4-5-19-17(12-16)18-14-23(2)11-8-20(18)24(19)13-15-6-9-22-10-7-15/h4-7,9-10,12H,3,8,11,13-14H2,1-2H3 |
| InChIKey | GHDLKEZAHQXVKF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|