C26H26N2O5 — CID 68926691
[4-[5-(hydroxymethyl)-2,2-dimethyl-3-oxo-1,4-dihydroquinoxalin-6-yl]-3-methoxyphenyl] 2-methylbenzoate (PubChem CID 68926691) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is [4-[5-(hydroxymethyl)-2,2-dimethyl-3-oxo-1,4-dihydroquinoxalin-6-yl]-3-methoxyphenyl] 2-methylbenzoate.
| Compound Name | [4-[5-(hydroxymethyl)-2,2-dimethyl-3-oxo-1,4-dihydroquinoxalin-6-yl]-3-methoxyphenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 68926691 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [4-[5-(hydroxymethyl)-2,2-dimethyl-3-oxo-1,4-dihydroquinoxalin-6-yl]-3-methoxyphenyl] 2-methylbenzoate |
| SMILES | COc1cc(OC(=O)c2ccccc2C)ccc1-c1ccc2c(c1CO)NC(=O)C(C)(C)N2 |
| InChI | InChI=1S/C26H26N2O5/c1-15-7-5-6-8-17(15)24(30)33-16-9-10-19(22(13-16)32-4)18-11-12-21-23(20(18)14-29)27-25(31)26(2,3)28-21/h5-13,28-29H,14H2,1-4H3,(H,27,31) |
| InChIKey | UFCQKGRBJBMHIP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|