About cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate
cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate (PubChem CID 68926707) has the molecular formula C22H19F2N3O4
and a molecular weight of 427.41 g/mol. Its IUPAC name is cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate.
Molecular Properties
| Compound Name | cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate |
| PubChem CID | 68926707 |
| Molecular Formula | C22H19F2N3O4 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate |
| SMILES | COc1c(C(=O)OCC2CC2)ccc2c1c(C=Cc1ccc(F)c(F)c1)nn2C(N)=O |
| InChI | InChI=1S/C22H19F2N3O4/c1-30-20-14(21(28)31-11-13-2-3-13)6-9-18-19(20)17(26-27(18)22(25)29)8-5-12-4-7-15(23)16(24)10-12/h4-10,13H,2-3,11H2,1H3,(H2,25,29) |
| InChIKey | GOTXZTRCIKHSNE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate?
The IUPAC name of cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate (CID 68926707) is cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate.
What is the SMILES notation for cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate?
The canonical SMILES for cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate is COc1c(C(=O)OCC2CC2)ccc2c1c(C=Cc1ccc(F)c(F)c1)nn2C(N)=O.
What is the InChIKey of cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate?
The InChIKey is GOTXZTRCIKHSNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19F2N3O4/c1-30-20-14(21(28)31-11-13-2-3-13)6-9-18-19(20)17(26-27(18)22(25)29)8-5-12-4-7-15(23)16(24)10-12/h4-10,13H,2-3,11H2,1H3,(H2,25,29).
What are the key properties of cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate?
cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate has a molecular weight of 427.41 g/mol, XLogP of 3.99, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethyl 1-carbamoyl-3-[2-(3,4-difluorophenyl)ethenyl]-4-methoxyindazole-5-carboxylate is sourced from PubChem (CID 68926707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).