About 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate
1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate (PubChem CID 68926715) has the molecular formula C26H28FN3O6
and a molecular weight of 497.52 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate |
| PubChem CID | 68926715 |
| Molecular Formula | C26H28FN3O6 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2c(c(C=Cc3ccc(F)cc3)nn2C(=O)OC(C)(C)C)c1OCCC(N)=O |
| InChI | InChI=1S/C26H28FN3O6/c1-5-34-24(32)18-11-13-20-22(23(18)35-15-14-21(28)31)19(12-8-16-6-9-17(27)10-7-16)29-30(20)25(33)36-26(2,3)4/h6-13H,5,14-15H2,1-4H3,(H2,28,31) |
| InChIKey | WWTFJTWHPHCKHQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate (CID 68926715) is 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate is CCOC(=O)c1ccc2c(c(C=Cc3ccc(F)cc3)nn2C(=O)OC(C)(C)C)c1OCCC(N)=O.
What is the InChIKey of 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate?
The InChIKey is WWTFJTWHPHCKHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28FN3O6/c1-5-34-24(32)18-11-13-20-22(23(18)35-15-14-21(28)31)19(12-8-16-6-9-17(27)10-7-16)29-30(20)25(33)36-26(2,3)4/h6-13H,5,14-15H2,1-4H3,(H2,28,31).
What are the key properties of 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate?
1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate has a molecular weight of 497.52 g/mol, XLogP of 4.56, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-ethyl 4-(3-amino-3-oxopropoxy)-3-[2-(4-fluorophenyl)ethenyl]indazole-1,5-dicarboxylate is sourced from PubChem (CID 68926715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).