C15H14ClN5 — CID 6892712
(E)-1-(2-chloro-6-methylquinolin-3-yl)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 6892712) has the molecular formula C15H14ClN5 and a molecular weight of 299.77 g/mol. Its IUPAC name is (E)-1-(2-chloro-6-methylquinolin-3-yl)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-(2-chloro-6-methylquinolin-3-yl)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 6892712 |
| Molecular Formula | C15H14ClN5 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (E)-1-(2-chloro-6-methylquinolin-3-yl)-N-(3,5-dimethyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | Cc1ccc2nc(Cl)c(/C=N/n3c(C)nnc3C)cc2c1 |
| InChI | InChI=1S/C15H14ClN5/c1-9-4-5-14-12(6-9)7-13(15(16)18-14)8-17-21-10(2)19-20-11(21)3/h4-8H,1-3H3/b17-8+ |
| InChIKey | WGYWGZQFTNUBBV-CAOOACKPSA-N |
| XLogP | 3.29 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|