C17H26ClN3O3 — CID 68927330
[6-(oxolan-3-yloxy)-3-pyridinyl]-(4-propan-2-ylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 68927330) has the molecular formula C17H26ClN3O3 and a molecular weight of 355.87 g/mol. Its IUPAC name is [6-(oxolan-3-yloxy)-3-pyridinyl]-(4-propan-2-ylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | [6-(oxolan-3-yloxy)-3-pyridinyl]-(4-propan-2-ylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 68927330 |
| Molecular Formula | C17H26ClN3O3 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | [6-(oxolan-3-yloxy)-3-pyridinyl]-(4-propan-2-ylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CC(C)N1CCN(C(=O)c2ccc(OC3CCOC3)nc2)CC1.Cl |
| InChI | InChI=1S/C17H25N3O3.ClH/c1-13(2)19-6-8-20(9-7-19)17(21)14-3-4-16(18-11-14)23-15-5-10-22-12-15;/h3-4,11,13,15H,5-10,12H2,1-2H3;1H |
| InChIKey | IDTPRHUDOBMBIK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |