C19H22FNO — CID 68927392
(3S)-3-[[2-(3,4-dimethylphenyl)-5-fluorophenyl]methoxy]pyrrolidine (PubChem CID 68927392) has the molecular formula C19H22FNO and a molecular weight of 299.39 g/mol. Its IUPAC name is (3S)-3-[[2-(3,4-dimethylphenyl)-5-fluorophenyl]methoxy]pyrrolidine.
| Compound Name | (3S)-3-[[2-(3,4-dimethylphenyl)-5-fluorophenyl]methoxy]pyrrolidine |
|---|---|
| PubChem CID | 68927392 |
| Molecular Formula | C19H22FNO |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (3S)-3-[[2-(3,4-dimethylphenyl)-5-fluorophenyl]methoxy]pyrrolidine |
| SMILES | Cc1ccc(-c2ccc(F)cc2CO[C@H]2CCNC2)cc1C |
| InChI | InChI=1S/C19H22FNO/c1-13-3-4-15(9-14(13)2)19-6-5-17(20)10-16(19)12-22-18-7-8-21-11-18/h3-6,9-10,18,21H,7-8,11-12H2,1-2H3/t18-/m0/s1 |
| InChIKey | RHKMDWOBNJGCDZ-SFHVURJKSA-N |
| XLogP | 3.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |