C18H18BrClN2 — CID 68927585
6-bromo-N-phenyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine;hydrochloride (PubChem CID 68927585) has the molecular formula C18H18BrClN2 and a molecular weight of 377.71 g/mol. Its IUPAC name is 6-bromo-N-phenyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine;hydrochloride.
| Compound Name | 6-bromo-N-phenyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine;hydrochloride |
|---|---|
| PubChem CID | 68927585 |
| Molecular Formula | C18H18BrClN2 |
| Molecular Weight | 377.71 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 6-bromo-N-phenyl-2,3,4,9-tetrahydro-1H-carbazol-1-amine;hydrochloride |
| SMILES | Brc1ccc2[nH]c3c(c2c1)CCCC3Nc1ccccc1.Cl |
| InChI | InChI=1S/C18H17BrN2.ClH/c19-12-9-10-16-15(11-12)14-7-4-8-17(18(14)21-16)20-13-5-2-1-3-6-13;/h1-3,5-6,9-11,17,20-21H,4,7-8H2;1H |
| InChIKey | IOAOAEAWXKYRNX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.71 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|