About 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile
4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 68927590) has the molecular formula C17H13F3N2
and a molecular weight of 302.30 g/mol. Its IUPAC name is 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile |
| PubChem CID | 68927590 |
| Molecular Formula | C17H13F3N2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N[C@@H]2CCc3ccccc32)cc1C(F)(F)F |
| InChI | InChI=1S/C17H13F3N2/c18-17(19,20)15-9-13(7-5-12(15)10-21)22-16-8-6-11-3-1-2-4-14(11)16/h1-5,7,9,16,22H,6,8H2/t16-/m1/s1 |
| InChIKey | RMWJVMQHQUARIE-MRXNPFEDSA-N |
| XLogP | 4.68 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile?
The IUPAC name of 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile (CID 68927590) is 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile?
The canonical SMILES for 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile is N#Cc1ccc(N[C@@H]2CCc3ccccc32)cc1C(F)(F)F.
What is the InChIKey of 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile?
The InChIKey is RMWJVMQHQUARIE-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H13F3N2/c18-17(19,20)15-9-13(7-5-12(15)10-21)22-16-8-6-11-3-1-2-4-14(11)16/h1-5,7,9,16,22H,6,8H2/t16-/m1/s1.
What are the key properties of 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile?
4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile has a molecular weight of 302.30 g/mol, XLogP of 4.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R)-2,3-dihydro-1H-inden-1-yl]amino]-2-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 68927590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).