C16H30N12 — CID 68927664
2-N-(2-aminoethyl)-2-N-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-4-N,4-N,6-N,6-N-tetramethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 68927664) has the molecular formula C16H30N12 and a molecular weight of 390.50 g/mol. Its IUPAC name is 2-N-(2-aminoethyl)-2-N-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-4-N,4-N,6-N,6-N-tetramethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(2-aminoethyl)-2-N-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-4-N,4-N,6-N,6-N-tetramethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 68927664 |
| Molecular Formula | C16H30N12 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 2-N-(2-aminoethyl)-2-N-[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]-4-N,4-N,6-N,6-N-tetramethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N(C)C)nc(N(CCN)c2nc(N(C)C)nc(N(C)C)n2)n1 |
| InChI | InChI=1S/C16H30N12/c1-24(2)11-18-12(25(3)4)21-15(20-11)28(10-9-17)16-22-13(26(5)6)19-14(23-16)27(7)8/h9-10,17H2,1-8H3 |
| InChIKey | UQCCYKQYDZRHJY-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |