About (4-ethenylphenyl)methylphosphanium;methanol;chloride
(4-ethenylphenyl)methylphosphanium;methanol;chloride (PubChem CID 68927835) has the molecular formula C10H16ClOP
and a molecular weight of 218.66 g/mol. Its IUPAC name is (4-ethenylphenyl)methylphosphanium;methanol;chloride.
Molecular Properties
| Compound Name | (4-ethenylphenyl)methylphosphanium;methanol;chloride |
| PubChem CID | 68927835 |
| Molecular Formula | C10H16ClOP |
| Molecular Weight | 218.66 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | (4-ethenylphenyl)methylphosphanium;methanol;chloride |
| SMILES | C=Cc1ccc(C[PH3+])cc1.CO.[Cl-] |
| InChI | InChI=1S/C9H11P.CH4O.ClH/c1-2-8-3-5-9(7-10)6-4-8;1-2;/h2-6H,1,7,10H2;2H,1H3;1H |
| InChIKey | RFLHPVDLBZSCJW-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.66 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-ethenylphenyl)methylphosphanium;methanol;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethenylphenyl)methylphosphanium;methanol;chloride?
The IUPAC name of (4-ethenylphenyl)methylphosphanium;methanol;chloride (CID 68927835) is (4-ethenylphenyl)methylphosphanium;methanol;chloride.
What is the SMILES notation for (4-ethenylphenyl)methylphosphanium;methanol;chloride?
The canonical SMILES for (4-ethenylphenyl)methylphosphanium;methanol;chloride is C=Cc1ccc(C[PH3+])cc1.CO.[Cl-].
What is the InChIKey of (4-ethenylphenyl)methylphosphanium;methanol;chloride?
The InChIKey is RFLHPVDLBZSCJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11P.CH4O.ClH/c1-2-8-3-5-9(7-10)6-4-8;1-2;/h2-6H,1,7,10H2;2H,1H3;1H.
What are the key properties of (4-ethenylphenyl)methylphosphanium;methanol;chloride?
(4-ethenylphenyl)methylphosphanium;methanol;chloride has a molecular weight of 218.66 g/mol, XLogP of -0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethenylphenyl)methylphosphanium;methanol;chloride is sourced from PubChem (CID 68927835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).