About 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese
2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese (PubChem CID 68927947) has the molecular formula C27H30MnN4O3
and a molecular weight of 513.50 g/mol. Its IUPAC name is 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese.
Molecular Properties
| Compound Name | 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese |
| PubChem CID | 68927947 |
| Molecular Formula | C27H30MnN4O3 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese |
| SMILES | Oc1ccccc1C1CC(N(C2CC(c3ccccc3O)N2)C2CC(c3ccccc3O)N2)N1.[Mn] |
| InChI | InChI=1S/C27H30N4O3.Mn/c32-22-10-4-1-7-16(22)19-13-25(28-19)31(26-14-20(29-26)17-8-2-5-11-23(17)33)27-15-21(30-27)18-9-3-6-12-24(18)34;/h1-12,19-21,25-30,32-34H,13-15H2; |
| InChIKey | YYUZHZVRYVHXGE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese?
The IUPAC name of 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese (CID 68927947) is 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese.
What is the SMILES notation for 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese?
The canonical SMILES for 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese is Oc1ccccc1C1CC(N(C2CC(c3ccccc3O)N2)C2CC(c3ccccc3O)N2)N1.[Mn].
What is the InChIKey of 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese?
The InChIKey is YYUZHZVRYVHXGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30N4O3.Mn/c32-22-10-4-1-7-16(22)19-13-25(28-19)31(26-14-20(29-26)17-8-2-5-11-23(17)33)27-15-21(30-27)18-9-3-6-12-24(18)34;/h1-12,19-21,25-30,32-34H,13-15H2;.
What are the key properties of 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese?
2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese has a molecular weight of 513.50 g/mol, XLogP of 3.58, 6 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[bis[4-(2-hydroxyphenyl)azetidin-2-yl]amino]azetidin-2-yl]phenol;manganese is sourced from PubChem (CID 68927947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).