About (2-ethyl-3-methylphenyl) hydrogen sulfite
(2-ethyl-3-methylphenyl) hydrogen sulfite (PubChem CID 68928017) has the molecular formula C9H12O3S
and a molecular weight of 200.26 g/mol. Its IUPAC name is (2-ethyl-3-methylphenyl) hydrogen sulfite.
Molecular Properties
| Compound Name | (2-ethyl-3-methylphenyl) hydrogen sulfite |
| PubChem CID | 68928017 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | (2-ethyl-3-methylphenyl) hydrogen sulfite |
| SMILES | CCc1c(C)cccc1OS(=O)O |
| InChI | InChI=1S/C9H12O3S/c1-3-8-7(2)5-4-6-9(8)12-13(10)11/h4-6H,3H2,1-2H3,(H,10,11) |
| InChIKey | PRBUYDMUZYPXDW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-3-methylphenyl) hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-3-methylphenyl) hydrogen sulfite?
The IUPAC name of (2-ethyl-3-methylphenyl) hydrogen sulfite (CID 68928017) is (2-ethyl-3-methylphenyl) hydrogen sulfite.
What is the SMILES notation for (2-ethyl-3-methylphenyl) hydrogen sulfite?
The canonical SMILES for (2-ethyl-3-methylphenyl) hydrogen sulfite is CCc1c(C)cccc1OS(=O)O.
What is the InChIKey of (2-ethyl-3-methylphenyl) hydrogen sulfite?
The InChIKey is PRBUYDMUZYPXDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3S/c1-3-8-7(2)5-4-6-9(8)12-13(10)11/h4-6H,3H2,1-2H3,(H,10,11).
What are the key properties of (2-ethyl-3-methylphenyl) hydrogen sulfite?
(2-ethyl-3-methylphenyl) hydrogen sulfite has a molecular weight of 200.26 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-3-methylphenyl) hydrogen sulfite is sourced from PubChem (CID 68928017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).