C23H25F3N2O3 — CID 68928715
2-[4-cyano-3-(trifluoromethyl)phenoxy]-N-[(2-methoxyphenyl)methyl]-4-methylhexanamide (PubChem CID 68928715) has the molecular formula C23H25F3N2O3 and a molecular weight of 434.46 g/mol. Its IUPAC name is 2-[4-cyano-3-(trifluoromethyl)phenoxy]-N-[(2-methoxyphenyl)methyl]-4-methylhexanamide.
| Compound Name | 2-[4-cyano-3-(trifluoromethyl)phenoxy]-N-[(2-methoxyphenyl)methyl]-4-methylhexanamide |
|---|---|
| PubChem CID | 68928715 |
| Molecular Formula | C23H25F3N2O3 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-[4-cyano-3-(trifluoromethyl)phenoxy]-N-[(2-methoxyphenyl)methyl]-4-methylhexanamide |
| SMILES | CCC(C)CC(Oc1ccc(C#N)c(C(F)(F)F)c1)C(=O)NCc1ccccc1OC |
| InChI | InChI=1S/C23H25F3N2O3/c1-4-15(2)11-21(22(29)28-14-17-7-5-6-8-20(17)30-3)31-18-10-9-16(13-27)19(12-18)23(24,25)26/h5-10,12,15,21H,4,11,14H2,1-3H3,(H,28,29) |
| InChIKey | BEQJDNQBSBXOAS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |