C36H27FN6 — CID 68929823
6-fluoro-5-(5-methyl-1H-1,2,4-triazol-3-yl)-3-[(E)-2-pyridin-3-ylethenyl]-1-tritylindazole (PubChem CID 68929823) has the molecular formula C36H27FN6 and a molecular weight of 562.65 g/mol. Its IUPAC name is 6-fluoro-5-(5-methyl-1H-1,2,4-triazol-3-yl)-3-[(E)-2-pyridin-3-ylethenyl]-1-tritylindazole.
| Compound Name | 6-fluoro-5-(5-methyl-1H-1,2,4-triazol-3-yl)-3-[(E)-2-pyridin-3-ylethenyl]-1-tritylindazole |
|---|---|
| PubChem CID | 68929823 |
| Molecular Formula | C36H27FN6 |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 6-fluoro-5-(5-methyl-1H-1,2,4-triazol-3-yl)-3-[(E)-2-pyridin-3-ylethenyl]-1-tritylindazole |
| SMILES | Cc1nc(-c2cc3c(/C=C/c4cccnc4)nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c3cc2F)n[nH]1 |
| InChI | InChI=1S/C36H27FN6/c1-25-39-35(41-40-25)30-22-31-33(20-19-26-12-11-21-38-24-26)42-43(34(31)23-32(30)37)36(27-13-5-2-6-14-27,28-15-7-3-8-16-28)29-17-9-4-10-18-29/h2-24H,1H3,(H,39,40,41)/b20-19+ |
| InChIKey | ZVJQLFNHJZJOCI-FMQUCBEESA-N |
| XLogP | 7.67 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|