C16H19IO3 — CID 68930588
1-[(1R,2S,3S)-7-hydroxy-3-(4-iodophenyl)-8-oxabicyclo[3.2.1]octan-2-yl]propan-1-one (PubChem CID 68930588) has the molecular formula C16H19IO3 and a molecular weight of 386.23 g/mol. Its IUPAC name is 1-[(1R,2S,3S)-7-hydroxy-3-(4-iodophenyl)-8-oxabicyclo[3.2.1]octan-2-yl]propan-1-one.
| Compound Name | 1-[(1R,2S,3S)-7-hydroxy-3-(4-iodophenyl)-8-oxabicyclo[3.2.1]octan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 68930588 |
| Molecular Formula | C16H19IO3 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 1-[(1R,2S,3S)-7-hydroxy-3-(4-iodophenyl)-8-oxabicyclo[3.2.1]octan-2-yl]propan-1-one |
| SMILES | CCC(=O)[C@H]1[C@@H](c2ccc(I)cc2)CC2CC(O)[C@@H]1O2 |
| InChI | InChI=1S/C16H19IO3/c1-2-13(18)15-12(9-3-5-10(17)6-4-9)7-11-8-14(19)16(15)20-11/h3-6,11-12,14-16,19H,2,7-8H2,1H3/t11?,12-,14?,15-,16+/m1/s1 |
| InChIKey | GUFVFGYQKIZXMG-RQETYVAKSA-N |
| XLogP | 2.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|