About azane;1-ethyl-2,4,6-trimethylpyridin-1-ium
azane;1-ethyl-2,4,6-trimethylpyridin-1-ium (PubChem CID 68931316) has the molecular formula C10H19N2+
and a molecular weight of 167.28 g/mol. Its IUPAC name is azane;1-ethyl-2,4,6-trimethylpyridin-1-ium.
Molecular Properties
| Compound Name | azane;1-ethyl-2,4,6-trimethylpyridin-1-ium |
| PubChem CID | 68931316 |
| Molecular Formula | C10H19N2+ |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.15 |
| IUPAC Name | azane;1-ethyl-2,4,6-trimethylpyridin-1-ium |
| SMILES | CC[n+]1c(C)cc(C)cc1C.N |
| InChI | InChI=1S/C10H16N.H3N/c1-5-11-9(3)6-8(2)7-10(11)4;/h6-7H,5H2,1-4H3;1H3/q+1; |
| InChIKey | LVNXDADVHGVODV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze azane;1-ethyl-2,4,6-trimethylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-ethyl-2,4,6-trimethylpyridin-1-ium?
The IUPAC name of azane;1-ethyl-2,4,6-trimethylpyridin-1-ium (CID 68931316) is azane;1-ethyl-2,4,6-trimethylpyridin-1-ium.
What is the SMILES notation for azane;1-ethyl-2,4,6-trimethylpyridin-1-ium?
The canonical SMILES for azane;1-ethyl-2,4,6-trimethylpyridin-1-ium is CC[n+]1c(C)cc(C)cc1C.N.
What is the InChIKey of azane;1-ethyl-2,4,6-trimethylpyridin-1-ium?
The InChIKey is LVNXDADVHGVODV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N.H3N/c1-5-11-9(3)6-8(2)7-10(11)4;/h6-7H,5H2,1-4H3;1H3/q+1;.
What are the key properties of azane;1-ethyl-2,4,6-trimethylpyridin-1-ium?
azane;1-ethyl-2,4,6-trimethylpyridin-1-ium has a molecular weight of 167.28 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-ethyl-2,4,6-trimethylpyridin-1-ium is sourced from PubChem (CID 68931316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).