C29H53F3O3Si2 — CID 68931325
(1R,3aR,7aR)-7a-methyl-1-[(6S)-1,1,1-trifluoro-6,10-dimethyl-2,10-bis(trimethylsilyloxy)undec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 68931325) has the molecular formula C29H53F3O3Si2 and a molecular weight of 562.91 g/mol. Its IUPAC name is (1R,3aR,7aR)-7a-methyl-1-[(6S)-1,1,1-trifluoro-6,10-dimethyl-2,10-bis(trimethylsilyloxy)undec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-7a-methyl-1-[(6S)-1,1,1-trifluoro-6,10-dimethyl-2,10-bis(trimethylsilyloxy)undec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 68931325 |
| Molecular Formula | C29H53F3O3Si2 |
| Molecular Weight | 562.91 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | (1R,3aR,7aR)-7a-methyl-1-[(6S)-1,1,1-trifluoro-6,10-dimethyl-2,10-bis(trimethylsilyloxy)undec-3-en-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC(C)(CCC[C@@](C)(CC=CC(O[Si](C)(C)C)C(F)(F)F)[C@H]1CC[C@H]2C(=O)CCC[C@]12C)O[Si](C)(C)C |
| InChI | InChI=1S/C29H53F3O3Si2/c1-26(2,35-37(8,9)10)18-13-20-27(3,19-12-15-25(29(30,31)32)34-36(5,6)7)24-17-16-22-23(33)14-11-21-28(22,24)4/h12,15,22,24-25H,11,13-14,16-21H2,1-10H3/t22-,24+,25?,27+,28-/m0/s1 |
| InChIKey | WXFMKSDALJASIH-RFDTUMLISA-N |
| XLogP | 9.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.91 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|