C18H20N2O3 — CID 6893140
N-[(E)-(2,4-dimethylphenyl)methylideneamino]-3,5-dimethoxybenzamide (PubChem CID 6893140) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[(E)-(2,4-dimethylphenyl)methylideneamino]-3,5-dimethoxybenzamide.
| Compound Name | N-[(E)-(2,4-dimethylphenyl)methylideneamino]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 6893140 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-[(E)-(2,4-dimethylphenyl)methylideneamino]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/N=C/c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-12-5-6-14(13(2)7-12)11-19-20-18(21)15-8-16(22-3)10-17(9-15)23-4/h5-11H,1-4H3,(H,20,21)/b19-11+ |
| InChIKey | DBHXLJRJNGRDIF-YBFXNURJSA-N |
| XLogP | 3.08 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|