C16H24N2O — CID 68932151
6-[3-(2-methoxyethylamino)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 68932151) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 6-[3-(2-methoxyethylamino)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 6-[3-(2-methoxyethylamino)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 68932151 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 6-[3-(2-methoxyethylamino)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | C=C(CNCCOC)c1ccc2c(c1)CCCC2N |
| InChI | InChI=1S/C16H24N2O/c1-12(11-18-8-9-19-2)13-6-7-15-14(10-13)4-3-5-16(15)17/h6-7,10,16,18H,1,3-5,8-9,11,17H2,2H3 |
| InChIKey | IKCXXROCLQKPNG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|