About 3-aminophenol;benzenesulfonylbenzene
3-aminophenol;benzenesulfonylbenzene (PubChem CID 68932329) has the molecular formula C18H17NO3S
and a molecular weight of 327.41 g/mol. Its IUPAC name is 3-aminophenol;benzenesulfonylbenzene.
Molecular Properties
| Compound Name | 3-aminophenol;benzenesulfonylbenzene |
| PubChem CID | 68932329 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 3-aminophenol;benzenesulfonylbenzene |
| SMILES | Nc1cccc(O)c1.O=S(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10O2S.C6H7NO/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-5-2-1-3-6(8)4-5/h1-10H;1-4,8H,7H2 |
| InChIKey | GGDGKPPWRGBFMD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-aminophenol;benzenesulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminophenol;benzenesulfonylbenzene?
The IUPAC name of 3-aminophenol;benzenesulfonylbenzene (CID 68932329) is 3-aminophenol;benzenesulfonylbenzene.
What is the SMILES notation for 3-aminophenol;benzenesulfonylbenzene?
The canonical SMILES for 3-aminophenol;benzenesulfonylbenzene is Nc1cccc(O)c1.O=S(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-aminophenol;benzenesulfonylbenzene?
The InChIKey is GGDGKPPWRGBFMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2S.C6H7NO/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;7-5-2-1-3-6(8)4-5/h1-10H;1-4,8H,7H2.
What are the key properties of 3-aminophenol;benzenesulfonylbenzene?
3-aminophenol;benzenesulfonylbenzene has a molecular weight of 327.41 g/mol, XLogP of 3.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminophenol;benzenesulfonylbenzene is sourced from PubChem (CID 68932329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).